C6H8F2N2 — CID 162594238
4-(difluoromethyl)-2,3-dihydropyridin-6-amine (PubChem CID 162594238) has the molecular formula C6H8F2N2 and a molecular weight of 146.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,3-dihydropyridin-6-amine.
| Compound Name | 4-(difluoromethyl)-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 162594238 |
| Molecular Formula | C6H8F2N2 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 4-(difluoromethyl)-2,3-dihydropyridin-6-amine |
| SMILES | NC1=NCCC(C(F)F)=C1 |
| InChI | InChI=1S/C6H8F2N2/c7-6(8)4-1-2-10-5(9)3-4/h3,6H,1-2H2,(H2,9,10) |
| InChIKey | NPTAFOBXMMMIJU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |