C5H7FN2 — CID 139521819
2-fluoro-2,3-dihydropyridin-6-amine (PubChem CID 139521819) has the molecular formula C5H7FN2 and a molecular weight of 114.12 g/mol. Its IUPAC name is 2-fluoro-2,3-dihydropyridin-6-amine.
| Compound Name | 2-fluoro-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 139521819 |
| Molecular Formula | C5H7FN2 |
| Molecular Weight | 114.12 g/mol |
| Exact Mass | 114.06 |
| IUPAC Name | 2-fluoro-2,3-dihydropyridin-6-amine |
| SMILES | NC1=NC(F)CC=C1 |
| InChI | InChI=1S/C5H7FN2/c6-4-2-1-3-5(7)8-4/h1,3-4H,2H2,(H2,7,8) |
| InChIKey | GDPNQKLIYNPGBB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|