C7H11FN2 — CID 138660627
4-(1-fluoroethyl)-2,3-dihydropyridin-6-amine (PubChem CID 138660627) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-2,3-dihydropyridin-6-amine.
| Compound Name | 4-(1-fluoroethyl)-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 138660627 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 4-(1-fluoroethyl)-2,3-dihydropyridin-6-amine |
| SMILES | CC(F)C1=CC(N)=NCC1 |
| InChI | InChI=1S/C7H11FN2/c1-5(8)6-2-3-10-7(9)4-6/h4-5H,2-3H2,1H3,(H2,9,10) |
| InChIKey | DZAPZFBWMPMRJG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |