C8H14N2 — CID 139453375
(5Z)-5-propylidene-3,4-dihydro-2H-pyridin-6-amine (PubChem CID 139453375) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (5Z)-5-propylidene-3,4-dihydro-2H-pyridin-6-amine.
| Compound Name | (5Z)-5-propylidene-3,4-dihydro-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 139453375 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (5Z)-5-propylidene-3,4-dihydro-2H-pyridin-6-amine |
| SMILES | CC/C=C1/CCCN=C1N |
| InChI | InChI=1S/C8H14N2/c1-2-4-7-5-3-6-10-8(7)9/h4H,2-3,5-6H2,1H3,(H2,9,10)/b7-4- |
| InChIKey | CDFLGNRACGAGAV-DAXSKMNVSA-N |
| XLogP | 1.47 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |