C24H26N2O3 — CID 123617905
1-ethyl-6-methylindole-3-carbaldehyde;1-ethyl-6-methylindole-3-carboxylic acid (PubChem CID 123617905) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-ethyl-6-methylindole-3-carbaldehyde;1-ethyl-6-methylindole-3-carboxylic acid.
| Compound Name | 1-ethyl-6-methylindole-3-carbaldehyde;1-ethyl-6-methylindole-3-carboxylic acid |
|---|---|
| PubChem CID | 123617905 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-ethyl-6-methylindole-3-carbaldehyde;1-ethyl-6-methylindole-3-carboxylic acid |
| SMILES | CCn1cc(C(=O)O)c2ccc(C)cc21.CCn1cc(C=O)c2ccc(C)cc21 |
| InChI | InChI=1S/C12H13NO2.C12H13NO/c1-3-13-7-10(12(14)15)9-5-4-8(2)6-11(9)13;1-3-13-7-10(8-14)11-5-4-9(2)6-12(11)13/h4-7H,3H2,1-2H3,(H,14,15);4-8H,3H2,1-2H3 |
| InChIKey | BZIYXYIXNLAAJR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|