C21H16ClN3O3S — CID 123618851
N-[3-[(4-chlorophenyl)-methylsulfamoyl]phenyl]-4-isocyanobenzamide (PubChem CID 123618851) has the molecular formula C21H16ClN3O3S and a molecular weight of 425.90 g/mol. Its IUPAC name is N-[3-[(4-chlorophenyl)-methylsulfamoyl]phenyl]-4-isocyanobenzamide.
| Compound Name | N-[3-[(4-chlorophenyl)-methylsulfamoyl]phenyl]-4-isocyanobenzamide |
|---|---|
| PubChem CID | 123618851 |
| Molecular Formula | C21H16ClN3O3S |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-[3-[(4-chlorophenyl)-methylsulfamoyl]phenyl]-4-isocyanobenzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2cccc(S(=O)(=O)N(C)c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C21H16ClN3O3S/c1-23-17-10-6-15(7-11-17)21(26)24-18-4-3-5-20(14-18)29(27,28)25(2)19-12-8-16(22)9-13-19/h3-14H,2H3,(H,24,26) |
| InChIKey | VGBZBDUHDFHYIB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|