C20H16ClN3O5S — CID 86729965
6-[[3-[(4-chlorophenyl)-methylsulfamoyl]benzoyl]amino]pyridine-3-carboxylic acid (PubChem CID 86729965) has the molecular formula C20H16ClN3O5S and a molecular weight of 445.88 g/mol. Its IUPAC name is 6-[[3-[(4-chlorophenyl)-methylsulfamoyl]benzoyl]amino]pyridine-3-carboxylic acid.
| Compound Name | 6-[[3-[(4-chlorophenyl)-methylsulfamoyl]benzoyl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 86729965 |
| Molecular Formula | C20H16ClN3O5S |
| Molecular Weight | 445.88 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 6-[[3-[(4-chlorophenyl)-methylsulfamoyl]benzoyl]amino]pyridine-3-carboxylic acid |
| SMILES | CN(c1ccc(Cl)cc1)S(=O)(=O)c1cccc(C(=O)Nc2ccc(C(=O)O)cn2)c1 |
| InChI | InChI=1S/C20H16ClN3O5S/c1-24(16-8-6-15(21)7-9-16)30(28,29)17-4-2-3-13(11-17)19(25)23-18-10-5-14(12-22-18)20(26)27/h2-12H,1H3,(H,26,27)(H,22,23,25) |
| InChIKey | ANEFAFGITMCBAK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |