C25H38N2O3 — CID 123619457
(8R,9S,10R,13S,14S)-3-[(2-aminocyclopentyl)oxyamino]-10,13-dimethyl-17-oxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbaldehyde (PubChem CID 123619457) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-[(2-aminocyclopentyl)oxyamino]-10,13-dimethyl-17-oxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbaldehyde.
| Compound Name | (8R,9S,10R,13S,14S)-3-[(2-aminocyclopentyl)oxyamino]-10,13-dimethyl-17-oxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbaldehyde |
|---|---|
| PubChem CID | 123619457 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-[(2-aminocyclopentyl)oxyamino]-10,13-dimethyl-17-oxo-1,2,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-7-carbaldehyde |
| SMILES | C[C@]12CCC(NOC3CCCC3N)=CC1CC(C=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H38N2O3/c1-24-10-8-17(27-30-21-5-3-4-20(21)26)13-16(24)12-15(14-28)23-18-6-7-22(29)25(18,2)11-9-19(23)24/h13-16,18-21,23,27H,3-12,26H2,1-2H3/t15?,16?,18-,19-,20?,21?,23-,24-,25-/m0/s1 |
| InChIKey | XEAGZMVJQWHYKR-RYOXTNIDSA-N |
| XLogP | 3.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|