C15H27NO2 — CID 123619609
1-(3,3-dimethylbutanoyl)-4-ethylazepane-3-carbaldehyde (PubChem CID 123619609) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-(3,3-dimethylbutanoyl)-4-ethylazepane-3-carbaldehyde.
| Compound Name | 1-(3,3-dimethylbutanoyl)-4-ethylazepane-3-carbaldehyde |
|---|---|
| PubChem CID | 123619609 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-(3,3-dimethylbutanoyl)-4-ethylazepane-3-carbaldehyde |
| SMILES | CCC1CCCN(C(=O)CC(C)(C)C)CC1C=O |
| InChI | InChI=1S/C15H27NO2/c1-5-12-7-6-8-16(10-13(12)11-17)14(18)9-15(2,3)4/h11-13H,5-10H2,1-4H3 |
| InChIKey | JNLNPTVAEWLJAF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|