C11H19N3 — CID 123620499
4-(diethylamino)cyclohexa-1,3-diene-1-carboximidamide (PubChem CID 123620499) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-(diethylamino)cyclohexa-1,3-diene-1-carboximidamide.
| Compound Name | 4-(diethylamino)cyclohexa-1,3-diene-1-carboximidamide |
|---|---|
| PubChem CID | 123620499 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 4-(diethylamino)cyclohexa-1,3-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CC=C(N(CC)CC)CC1 |
| InChI | InChI=1S/C11H19N3/c1-3-14(4-2)10-7-5-9(6-8-10)11(12)13/h5,7H,3-4,6,8H2,1-2H3,(H3,12,13) |
| InChIKey | RKRGTZTTWDUFOJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|