C13H22N2 — CID 170582300
[1-ethyl-6-[(Z)-3-methylbut-1-enyl]-3,4-dihydro-2H-pyridin-5-yl]methanimine (PubChem CID 170582300) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is [1-ethyl-6-[(Z)-3-methylbut-1-enyl]-3,4-dihydro-2H-pyridin-5-yl]methanimine.
| Compound Name | [1-ethyl-6-[(Z)-3-methylbut-1-enyl]-3,4-dihydro-2H-pyridin-5-yl]methanimine |
|---|---|
| PubChem CID | 170582300 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | [1-ethyl-6-[(Z)-3-methylbut-1-enyl]-3,4-dihydro-2H-pyridin-5-yl]methanimine |
| SMILES | [H]/N=C/C1=C(/C=C\C(C)C)N(CC)CCC1 |
| InChI | InChI=1S/C13H22N2/c1-4-15-9-5-6-12(10-14)13(15)8-7-11(2)3/h7-8,10-11,14H,4-6,9H2,1-3H3/b8-7-,14-10+ |
| InChIKey | FKCNLXXICCFTFM-HCDFZPOGSA-N |
| XLogP | 3.22 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|