C55H102O6 — CID 123620759
8-[4-[4-(cyclohexen-1-yl)butyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate (PubChem CID 123620759) has the molecular formula C55H102O6 and a molecular weight of 859.41 g/mol. Its IUPAC name is 8-[4-[4-(cyclohexen-1-yl)butyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate.
| Compound Name | 8-[4-[4-(cyclohexen-1-yl)butyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate |
|---|---|
| PubChem CID | 123620759 |
| Molecular Formula | C55H102O6 |
| Molecular Weight | 859.41 g/mol |
| Exact Mass | 858.77 |
| IUPAC Name | 8-[4-[4-(cyclohexen-1-yl)butyl]-2-[8-(3-pentyloctanoyloxy)octyl]-1,3-dioxolan-2-yl]octyl 3-pentyloctanoate |
| SMILES | CCCCCC(CCCCC)CC(=O)OCCCCCCCCC1(CCCCCCCCOC(=O)CC(CCCCC)CCCCC)OCC(CCCCC2=CCCCC2)O1 |
| InChI | InChI=1S/C55H102O6/c1-5-9-22-37-50(38-23-10-6-2)46-53(56)58-44-32-19-15-13-17-30-42-55(60-48-52(61-55)41-29-28-36-49-34-26-21-27-35-49)43-31-18-14-16-20-33-45-59-54(57)47-51(39-24-11-7-3)40-25-12-8-4/h34,50-52H,5-33,35-48H2,1-4H3 |
| InChIKey | YDZYYHHZIJJSDA-UHFFFAOYSA-N |
| XLogP | 17.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.41 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|