C19H30O4 — CID 134954880
tert-butyl 4-spiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-3'-ylbutanoate (PubChem CID 134954880) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is tert-butyl 4-spiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-3'-ylbutanoate.
| Compound Name | tert-butyl 4-spiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-3'-ylbutanoate |
|---|---|
| PubChem CID | 134954880 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 4-spiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-3'-ylbutanoate |
| SMILES | CC(C)(C)OC(=O)CCCC1=CC2CC(C1)CC1(C2)OCCO1 |
| InChI | InChI=1S/C19H30O4/c1-18(2,3)23-17(20)6-4-5-14-9-15-11-16(10-14)13-19(12-15)21-7-8-22-19/h9,15-16H,4-8,10-13H2,1-3H3 |
| InChIKey | PXSSUENHSWJUNG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|