C21H34O4 — CID 11595487
methyl (1S,5S,6R,8aS)-1,5,6-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 11595487) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (1S,5S,6R,8aS)-1,5,6-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (1S,5S,6R,8aS)-1,5,6-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11595487 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (1S,5S,6R,8aS)-1,5,6-trimethyl-5-[2-(2-methyl-1,3-dioxolan-2-yl)ethyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC=C2[C@@H]1CC[C@@H](C)[C@]2(C)CCC1(C)OCCO1 |
| InChI | InChI=1S/C21H34O4/c1-15-8-9-17-16(7-6-10-20(17,3)18(22)23-5)19(15,2)11-12-21(4)24-13-14-25-21/h7,15,17H,6,8-14H2,1-5H3/t15-,17+,19+,20+/m1/s1 |
| InChIKey | YANQVDBWWMMCHT-LQJIQPLVSA-N |
| XLogP | 4.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|