C25H23F3N2O4S — CID 123621586
N-(3-carbazol-9-yl-2-hydroxycyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 123621586) has the molecular formula C25H23F3N2O4S and a molecular weight of 504.53 g/mol. Its IUPAC name is N-(3-carbazol-9-yl-2-hydroxycyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-carbazol-9-yl-2-hydroxycyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 123621586 |
| Molecular Formula | C25H23F3N2O4S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | N-(3-carbazol-9-yl-2-hydroxycyclohexyl)-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC(n2c3ccccc3c3ccccc32)C1O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F3N2O4S/c26-25(27,28)34-16-12-14-17(15-13-16)35(32,33)29-20-8-5-11-23(24(20)31)30-21-9-3-1-6-18(21)19-7-2-4-10-22(19)30/h1-4,6-7,9-10,12-15,20,23-24,29,31H,5,8,11H2 |
| InChIKey | QXJHORIEWIEORM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |