About 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate
1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate (PubChem CID 123621614) has the molecular formula C8H12O7
and a molecular weight of 220.18 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate |
| PubChem CID | 123621614 |
| Molecular Formula | C8H12O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate |
| SMILES | CC(C)(C)OOC(=O)C=CC(=O)OOO |
| InChI | InChI=1S/C8H12O7/c1-8(2,3)14-12-6(9)4-5-7(10)13-15-11/h4-5,11H,1-3H3 |
| InChIKey | QPMJAHZFZLIUSN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate?
The IUPAC name of 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate (CID 123621614) is 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate.
What is the SMILES notation for 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate?
The canonical SMILES for 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate is CC(C)(C)OOC(=O)C=CC(=O)OOO.
What is the InChIKey of 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate?
The InChIKey is QPMJAHZFZLIUSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O7/c1-8(2,3)14-12-6(9)4-5-7(10)13-15-11/h4-5,11H,1-3H3.
What are the key properties of 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate?
1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate has a molecular weight of 220.18 g/mol, XLogP of 0.76, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-hydroxy but-2-enediperoxoate is sourced from PubChem (CID 123621614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).