C13H24O7Si — CID 123621626
methoxy-[3,3,3-tris(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 123621626) has the molecular formula C13H24O7Si and a molecular weight of 320.41 g/mol. Its IUPAC name is methoxy-[3,3,3-tris(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | methoxy-[3,3,3-tris(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 123621626 |
| Molecular Formula | C13H24O7Si |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | methoxy-[3,3,3-tris(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | CO[SiH2]CCC(OCC1CO1)(OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C13H24O7Si/c1-14-21-3-2-13(18-7-10-4-15-10,19-8-11-5-16-11)20-9-12-6-17-12/h10-12H,2-9,21H2,1H3 |
| InChIKey | RJQQISJPVOWWSS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|