C10H23N5O4 — CID 56622855
1,1-bis(oxiran-2-ylmethoxy)butane-1,2,2,3,3-pentamine (PubChem CID 56622855) has the molecular formula C10H23N5O4 and a molecular weight of 277.33 g/mol. Its IUPAC name is 1,1-bis(oxiran-2-ylmethoxy)butane-1,2,2,3,3-pentamine.
| Compound Name | 1,1-bis(oxiran-2-ylmethoxy)butane-1,2,2,3,3-pentamine |
|---|---|
| PubChem CID | 56622855 |
| Molecular Formula | C10H23N5O4 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1,1-bis(oxiran-2-ylmethoxy)butane-1,2,2,3,3-pentamine |
| SMILES | CC(N)(N)C(N)(N)C(N)(OCC1CO1)OCC1CO1 |
| InChI | InChI=1S/C10H23N5O4/c1-8(11,12)9(13,14)10(15,18-4-6-2-16-6)19-5-7-3-17-7/h6-7H,2-5,11-15H2,1H3 |
| InChIKey | VUAJOYFDDVDFAV-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 173.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|