C19H36O5 — CID 155574162
2,4-bis[2-(oxiran-2-ylmethoxy)propan-2-yl]oxetane;ethane;ethene (PubChem CID 155574162) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is 2,4-bis[2-(oxiran-2-ylmethoxy)propan-2-yl]oxetane;ethane;ethene.
| Compound Name | 2,4-bis[2-(oxiran-2-ylmethoxy)propan-2-yl]oxetane;ethane;ethene |
|---|---|
| PubChem CID | 155574162 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 2,4-bis[2-(oxiran-2-ylmethoxy)propan-2-yl]oxetane;ethane;ethene |
| SMILES | C=C.CC.CC(C)(OCC1CO1)C1CC(C(C)(C)OCC2CO2)O1 |
| InChI | InChI=1S/C15H26O5.C2H6.C2H4/c1-14(2,18-8-10-6-16-10)12-5-13(20-12)15(3,4)19-9-11-7-17-11;2*1-2/h10-13H,5-9H2,1-4H3;1-2H3;1-2H2 |
| InChIKey | OPJWSRDJWLGWOQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|