C30H26ClF3N4O3 — CID 123622260
3-(6-amino-3-pyridinyl)-N-[[5-[4-(4-chloropiperidine-1-carbonyl)phenyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]prop-2-enamide (PubChem CID 123622260) has the molecular formula C30H26ClF3N4O3 and a molecular weight of 583.01 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-[[5-[4-(4-chloropiperidine-1-carbonyl)phenyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-[[5-[4-(4-chloropiperidine-1-carbonyl)phenyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123622260 |
| Molecular Formula | C30H26ClF3N4O3 |
| Molecular Weight | 583.01 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-[[5-[4-(4-chloropiperidine-1-carbonyl)phenyl]-7-(trifluoromethyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
| SMILES | Nc1ccc(C=CC(=O)NCc2cc3cc(-c4ccc(C(=O)N5CCC(Cl)CC5)cc4)cc(C(F)(F)F)c3o2)cn1 |
| InChI | InChI=1S/C30H26ClF3N4O3/c31-23-9-11-38(12-10-23)29(40)20-5-3-19(4-6-20)21-13-22-14-24(41-28(22)25(15-21)30(32,33)34)17-37-27(39)8-2-18-1-7-26(35)36-16-18/h1-8,13-16,23H,9-12,17H2,(H2,35,36)(H,37,39) |
| InChIKey | OHXHLXSNYNXKHX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.01 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|