C30H30N4O3 — CID 123612711
3-(6-amino-3-pyridinyl)-N-[[7-methyl-5-[4-(piperidine-1-carbonyl)phenyl]-1-benzofuran-2-yl]methyl]prop-2-enamide (PubChem CID 123612711) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-[[7-methyl-5-[4-(piperidine-1-carbonyl)phenyl]-1-benzofuran-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-[[7-methyl-5-[4-(piperidine-1-carbonyl)phenyl]-1-benzofuran-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 123612711 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-[[7-methyl-5-[4-(piperidine-1-carbonyl)phenyl]-1-benzofuran-2-yl]methyl]prop-2-enamide |
| SMILES | Cc1cc(-c2ccc(C(=O)N3CCCCC3)cc2)cc2cc(CNC(=O)C=Cc3ccc(N)nc3)oc12 |
| InChI | InChI=1S/C30H30N4O3/c1-20-15-24(22-7-9-23(10-8-22)30(36)34-13-3-2-4-14-34)16-25-17-26(37-29(20)25)19-33-28(35)12-6-21-5-11-27(31)32-18-21/h5-12,15-18H,2-4,13-14,19H2,1H3,(H2,31,32)(H,33,35) |
| InChIKey | GUECDOUYDYBQKT-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|