C28H29N3O2 — CID 144770692
(E)-3-(6-amino-3-pyridinyl)-N-[[7-tert-butyl-5-(4-methylphenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide (PubChem CID 144770692) has the molecular formula C28H29N3O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is (E)-3-(6-amino-3-pyridinyl)-N-[[7-tert-butyl-5-(4-methylphenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(6-amino-3-pyridinyl)-N-[[7-tert-butyl-5-(4-methylphenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 144770692 |
| Molecular Formula | C28H29N3O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (E)-3-(6-amino-3-pyridinyl)-N-[[7-tert-butyl-5-(4-methylphenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)c3oc(CNC(=O)/C=C/c4ccc(N)nc4)cc3c2)cc1 |
| InChI | InChI=1S/C28H29N3O2/c1-18-5-9-20(10-6-18)21-13-22-14-23(33-27(22)24(15-21)28(2,3)4)17-31-26(32)12-8-19-7-11-25(29)30-16-19/h5-16H,17H2,1-4H3,(H2,29,30)(H,31,32)/b12-8+ |
| InChIKey | COILCFSICQNFHX-XYOKQWHBSA-N |
| XLogP | 6.01 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|