C23H17BrFN3O2 — CID 175738109
3-(6-amino-3-pyridinyl)-N-[[5-bromo-7-(4-fluorophenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide (PubChem CID 175738109) has the molecular formula C23H17BrFN3O2 and a molecular weight of 466.31 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-N-[[5-bromo-7-(4-fluorophenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-N-[[5-bromo-7-(4-fluorophenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 175738109 |
| Molecular Formula | C23H17BrFN3O2 |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-N-[[5-bromo-7-(4-fluorophenyl)-1-benzofuran-2-yl]methyl]prop-2-enamide |
| SMILES | Nc1ccc(C=CC(=O)NCc2cc3cc(Br)cc(-c4ccc(F)cc4)c3o2)cn1 |
| InChI | InChI=1S/C23H17BrFN3O2/c24-17-9-16-10-19(13-28-22(29)8-2-14-1-7-21(26)27-12-14)30-23(16)20(11-17)15-3-5-18(25)6-4-15/h1-12H,13H2,(H2,26,27)(H,28,29) |
| InChIKey | LMHIMPOGZVCYRV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|