C13H25N — CID 123622566
N,N,5,6,7-pentamethylocta-2,4-dien-1-amine (PubChem CID 123622566) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is N,N,5,6,7-pentamethylocta-2,4-dien-1-amine.
| Compound Name | N,N,5,6,7-pentamethylocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123622566 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | N,N,5,6,7-pentamethylocta-2,4-dien-1-amine |
| SMILES | CC(=CC=CCN(C)C)C(C)C(C)C |
| InChI | InChI=1S/C13H25N/c1-11(2)13(4)12(3)9-7-8-10-14(5)6/h7-9,11,13H,10H2,1-6H3 |
| InChIKey | JMDWQMGPKXKSOG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|