C35H36ClN5O4S2 — CID 123622726
5-butyl-4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;3-methyl-10-(4-methylphenyl)sulfonyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene (PubChem CID 123622726) has the molecular formula C35H36ClN5O4S2 and a molecular weight of 690.29 g/mol. Its IUPAC name is 5-butyl-4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;3-methyl-10-(4-methylphenyl)sulfonyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene.
| Compound Name | 5-butyl-4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;3-methyl-10-(4-methylphenyl)sulfonyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
|---|---|
| PubChem CID | 123622726 |
| Molecular Formula | C35H36ClN5O4S2 |
| Molecular Weight | 690.29 g/mol |
| Exact Mass | 689.19 |
| IUPAC Name | 5-butyl-4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine;3-methyl-10-(4-methylphenyl)sulfonyl-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
| SMILES | CCCCc1cnc2c(ccn2S(=O)(=O)c2ccc(C)cc2)c1Cl.Cc1ccc(S(=O)(=O)n2ccc3c4c(cnc32)CCN4C)cc1 |
| InChI | InChI=1S/C18H19ClN2O2S.C17H17N3O2S/c1-3-4-5-14-12-20-18-16(17(14)19)10-11-21(18)24(22,23)15-8-6-13(2)7-9-15;1-12-3-5-14(6-4-12)23(21,22)20-10-8-15-16-13(7-9-19(16)2)11-18-17(15)20/h6-12H,3-5H2,1-2H3;3-6,8,10-11H,7,9H2,1-2H3 |
| InChIKey | TWNZWPNHKGVBEV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 107.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.29 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |