C19H27N3O2S — CID 123623608
tert-butyl (5R,7S)-7-methyl-1-(6-methyl-2-pyridinyl)-2-thia-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate (PubChem CID 123623608) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is tert-butyl (5R,7S)-7-methyl-1-(6-methyl-2-pyridinyl)-2-thia-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate.
| Compound Name | tert-butyl (5R,7S)-7-methyl-1-(6-methyl-2-pyridinyl)-2-thia-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
|---|---|
| PubChem CID | 123623608 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | tert-butyl (5R,7S)-7-methyl-1-(6-methyl-2-pyridinyl)-2-thia-1,8-diazaspiro[4.5]dec-3-ene-8-carboxylate |
| SMILES | Cc1cccc(N2SC=C[C@]23CCN(C(=O)OC(C)(C)C)[C@@H](C)C3)n1 |
| InChI | InChI=1S/C19H27N3O2S/c1-14-7-6-8-16(20-14)22-19(10-12-25-22)9-11-21(15(2)13-19)17(23)24-18(3,4)5/h6-8,10,12,15H,9,11,13H2,1-5H3/t15-,19-/m0/s1 |
| InChIKey | HEYKDAIBHWJVRJ-KXBFYZLASA-N |
| XLogP | 4.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|