About tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate
tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate (PubChem CID 168954589) has the molecular formula C14H21Cl2NO3
and a molecular weight of 322.23 g/mol. Its IUPAC name is tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate |
| PubChem CID | 168954589 |
| Molecular Formula | C14H21Cl2NO3 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC1CC2(CCN1C(=O)OC(C)(C)C)CC(=O)C2(Cl)Cl |
| InChI | InChI=1S/C14H21Cl2NO3/c1-9-7-13(8-10(18)14(13,15)16)5-6-17(9)11(19)20-12(2,3)4/h9H,5-8H2,1-4H3 |
| InChIKey | KCBPJURASHWZGR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate?
The IUPAC name of tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate (CID 168954589) is tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate.
What is the SMILES notation for tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate?
The canonical SMILES for tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate is CC1CC2(CCN1C(=O)OC(C)(C)C)CC(=O)C2(Cl)Cl.
What is the InChIKey of tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate?
The InChIKey is KCBPJURASHWZGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21Cl2NO3/c1-9-7-13(8-10(18)14(13,15)16)5-6-17(9)11(19)20-12(2,3)4/h9H,5-8H2,1-4H3.
What are the key properties of tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate?
tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate has a molecular weight of 322.23 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,3-dichloro-6-methyl-2-oxo-7-azaspiro[3.5]nonane-7-carboxylate is sourced from PubChem (CID 168954589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).