C22H31Cl2FN2O4 — CID 164812696
ditert-butyl (2R,4R)-4-[(4,6-dichloro-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylate (PubChem CID 164812696) has the molecular formula C22H31Cl2FN2O4 and a molecular weight of 477.40 g/mol. Its IUPAC name is ditert-butyl (2R,4R)-4-[(4,6-dichloro-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2R,4R)-4-[(4,6-dichloro-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 164812696 |
| Molecular Formula | C22H31Cl2FN2O4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | ditert-butyl (2R,4R)-4-[(4,6-dichloro-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylate |
| SMILES | C[C@@H]1C[C@](Cc2nc(Cl)cc(Cl)c2F)(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31Cl2FN2O4/c1-13-11-22(18(28)30-20(2,3)4,8-9-27(13)19(29)31-21(5,6)7)12-15-17(25)14(23)10-16(24)26-15/h10,13H,8-9,11-12H2,1-7H3/t13-,22-/m1/s1 |
| InChIKey | ZPQXAMCWMPIHAI-MCMMXHMISA-N |
| XLogP | 5.82 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|