C15H16ClFN2O5 — CID 175406031
4-[(6-chloro-3-fluoro-4-formyl-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid (PubChem CID 175406031) has the molecular formula C15H16ClFN2O5 and a molecular weight of 358.75 g/mol. Its IUPAC name is 4-[(6-chloro-3-fluoro-4-formyl-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid.
| Compound Name | 4-[(6-chloro-3-fluoro-4-formyl-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 175406031 |
| Molecular Formula | C15H16ClFN2O5 |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-[(6-chloro-3-fluoro-4-formyl-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
| SMILES | CC1CC(Cc2nc(Cl)cc(C=O)c2F)(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C15H16ClFN2O5/c1-8-5-15(13(21)22,2-3-19(8)14(23)24)6-10-12(17)9(7-20)4-11(16)18-10/h4,7-8H,2-3,5-6H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | YOYFUDJGPFJLJB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|