C14H13BrF4N2O4 — CID 164884448
4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid (PubChem CID 164884448) has the molecular formula C14H13BrF4N2O4 and a molecular weight of 429.16 g/mol. Its IUPAC name is 4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid.
| Compound Name | 4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 164884448 |
| Molecular Formula | C14H13BrF4N2O4 |
| Molecular Weight | 429.16 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 4-[(6-bromo-3-fluoro-2-pyridinyl)methyl]-2-(trifluoromethyl)piperidine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCC(Cc2nc(Br)ccc2F)(C(=O)O)CC1C(F)(F)F |
| InChI | InChI=1S/C14H13BrF4N2O4/c15-10-2-1-7(16)8(20-10)5-13(11(22)23)3-4-21(12(24)25)9(6-13)14(17,18)19/h1-2,9H,3-6H2,(H,22,23)(H,24,25) |
| InChIKey | YQYJFYJRAMQFAJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|