C19H26ClFN2O2 — CID 166677856
tert-butyl (2R)-4-[(6-chloro-4-ethenyl-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1-carboxylate (PubChem CID 166677856) has the molecular formula C19H26ClFN2O2 and a molecular weight of 368.88 g/mol. Its IUPAC name is tert-butyl (2R)-4-[(6-chloro-4-ethenyl-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[(6-chloro-4-ethenyl-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 166677856 |
| Molecular Formula | C19H26ClFN2O2 |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | tert-butyl (2R)-4-[(6-chloro-4-ethenyl-3-fluoro-2-pyridinyl)methyl]-2-methylpiperidine-1-carboxylate |
| SMILES | C=Cc1cc(Cl)nc(CC2CCN(C(=O)OC(C)(C)C)[C@H](C)C2)c1F |
| InChI | InChI=1S/C19H26ClFN2O2/c1-6-14-11-16(20)22-15(17(14)21)10-13-7-8-23(12(2)9-13)18(24)25-19(3,4)5/h6,11-13H,1,7-10H2,2-5H3/t12-,13?/m1/s1 |
| InChIKey | UMFPLPNZRSUAOC-PZORYLMUSA-N |
| XLogP | 5.10 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|