C24H31N3O3 — CID 130440755
tert-butyl 4-[2-(2-cyano-5-formyl-4-methylindol-1-yl)ethyl]-2-methylpiperidine-1-carboxylate (PubChem CID 130440755) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-cyano-5-formyl-4-methylindol-1-yl)ethyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-cyano-5-formyl-4-methylindol-1-yl)ethyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 130440755 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | tert-butyl 4-[2-(2-cyano-5-formyl-4-methylindol-1-yl)ethyl]-2-methylpiperidine-1-carboxylate |
| SMILES | Cc1c(C=O)ccc2c1cc(C#N)n2CCC1CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C24H31N3O3/c1-16-12-18(8-10-26(16)23(29)30-24(3,4)5)9-11-27-20(14-25)13-21-17(2)19(15-28)6-7-22(21)27/h6-7,13,15-16,18H,8-12H2,1-5H3 |
| InChIKey | VURMZAKUOMKHRU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|