C14H15ClF2N2O4 — CID 175405601
(2R)-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid (PubChem CID 175405601) has the molecular formula C14H15ClF2N2O4 and a molecular weight of 348.73 g/mol. Its IUPAC name is (2R)-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid.
| Compound Name | (2R)-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 175405601 |
| Molecular Formula | C14H15ClF2N2O4 |
| Molecular Weight | 348.73 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (2R)-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
| SMILES | C[C@@H]1CC(Cc2nc(Cl)c(F)cc2F)(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C14H15ClF2N2O4/c1-7-5-14(12(20)21,2-3-19(7)13(22)23)6-10-8(16)4-9(17)11(15)18-10/h4,7H,2-3,5-6H2,1H3,(H,20,21)(H,22,23)/t7-,14?/m1/s1 |
| InChIKey | PJRVSJUETVAYKL-SKKCEABJSA-N |
| XLogP | 2.79 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|