C22H31ClF2N2O4 — CID 163303825
(2R,4R)-2,3-ditert-butyl-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid (PubChem CID 163303825) has the molecular formula C22H31ClF2N2O4 and a molecular weight of 460.95 g/mol. Its IUPAC name is (2R,4R)-2,3-ditert-butyl-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid.
| Compound Name | (2R,4R)-2,3-ditert-butyl-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 163303825 |
| Molecular Formula | C22H31ClF2N2O4 |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2R,4R)-2,3-ditert-butyl-4-[(6-chloro-3,5-difluoro-2-pyridinyl)methyl]-2-methylpiperidine-1,4-dicarboxylic acid |
| SMILES | CC(C)(C)C1[C@@](Cc2nc(Cl)c(F)cc2F)(C(=O)O)CCN(C(=O)O)[C@@]1(C)C(C)(C)C |
| InChI | InChI=1S/C22H31ClF2N2O4/c1-19(2,3)16-21(7,20(4,5)6)27(18(30)31)9-8-22(16,17(28)29)11-14-12(24)10-13(25)15(23)26-14/h10,16H,8-9,11H2,1-7H3,(H,28,29)(H,30,31)/t16?,21-,22-/m1/s1 |
| InChIKey | FOPNOIUSEJUQCF-NKDCDXMNSA-N |
| XLogP | 5.48 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|