C13H16O9 — CID 123623625
[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-(3,4,5-trihydroxyphenyl)methanone (PubChem CID 123623625) has the molecular formula C13H16O9 and a molecular weight of 316.26 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-(3,4,5-trihydroxyphenyl)methanone.
| Compound Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-(3,4,5-trihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 123623625 |
| Molecular Formula | C13H16O9 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-(3,4,5-trihydroxyphenyl)methanone |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O9/c14-3-7-10(19)11(20)12(21)13(22-7)8(17)4-1-5(15)9(18)6(16)2-4/h1-2,7,10-16,18-21H,3H2/t7-,10-,11+,12-,13?/m1/s1 |
| InChIKey | LNNCIECPNXMAHU-DDSNRORXSA-N |
| XLogP | -2.17 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|