C16H18N4O3S — CID 123625580
5-(5-ethenyl-4-methylthiophene-2-carbonyl)-N-hydroxy-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide (PubChem CID 123625580) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-(5-ethenyl-4-methylthiophene-2-carbonyl)-N-hydroxy-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide.
| Compound Name | 5-(5-ethenyl-4-methylthiophene-2-carbonyl)-N-hydroxy-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 123625580 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-(5-ethenyl-4-methylthiophene-2-carbonyl)-N-hydroxy-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
| SMILES | C=Cc1sc(C(=O)N2CCCn3nc(C(=O)NO)cc3C2)cc1C |
| InChI | InChI=1S/C16H18N4O3S/c1-3-13-10(2)7-14(24-13)16(22)19-5-4-6-20-11(9-19)8-12(17-20)15(21)18-23/h3,7-8,23H,1,4-6,9H2,2H3,(H,18,21) |
| InChIKey | MMOWZEAJIGLNAM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|