C18H18N4O4 — CID 58465633
N-hydroxy-5-(3-methyl-1-benzofuran-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide (PubChem CID 58465633) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-hydroxy-5-(3-methyl-1-benzofuran-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide.
| Compound Name | N-hydroxy-5-(3-methyl-1-benzofuran-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
|---|---|
| PubChem CID | 58465633 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-hydroxy-5-(3-methyl-1-benzofuran-2-carbonyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-2-carboxamide |
| SMILES | Cc1c(C(=O)N2CCCn3nc(C(=O)NO)cc3C2)oc2ccccc12 |
| InChI | InChI=1S/C18H18N4O4/c1-11-13-5-2-3-6-15(13)26-16(11)18(24)21-7-4-8-22-12(10-21)9-14(19-22)17(23)20-25/h2-3,5-6,9,25H,4,7-8,10H2,1H3,(H,20,23) |
| InChIKey | QHARTOVGBHONGV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|