C7H5ClN2S — CID 123626262
3-chloro-1H-pyrrolo[2,3-b]pyridine-5-thiol (PubChem CID 123626262) has the molecular formula C7H5ClN2S and a molecular weight of 184.65 g/mol. Its IUPAC name is 3-chloro-1H-pyrrolo[2,3-b]pyridine-5-thiol.
| Compound Name | 3-chloro-1H-pyrrolo[2,3-b]pyridine-5-thiol |
|---|---|
| PubChem CID | 123626262 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.65 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 3-chloro-1H-pyrrolo[2,3-b]pyridine-5-thiol |
| SMILES | Sc1cnc2[nH]cc(Cl)c2c1 |
| InChI | InChI=1S/C7H5ClN2S/c8-6-3-10-7-5(6)1-4(11)2-9-7/h1-3,11H,(H,9,10) |
| InChIKey | QYUPNZKTSCXEQJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.65 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|