About 4,6-dichloro-2H-2,7-naphthyridin-1-one
4,6-dichloro-2H-2,7-naphthyridin-1-one (PubChem CID 134830487) has the molecular formula C8H4Cl2N2O
and a molecular weight of 215.04 g/mol. Its IUPAC name is 4,6-dichloro-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 4,6-dichloro-2H-2,7-naphthyridin-1-one |
| PubChem CID | 134830487 |
| Molecular Formula | C8H4Cl2N2O |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 4,6-dichloro-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]cc(Cl)c2cc(Cl)ncc12 |
| InChI | InChI=1S/C8H4Cl2N2O/c9-6-3-12-8(13)5-2-11-7(10)1-4(5)6/h1-3H,(H,12,13) |
| InChIKey | HZDCXLOERGXOGY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2H-2,7-naphthyridin-1-one?
The IUPAC name of 4,6-dichloro-2H-2,7-naphthyridin-1-one (CID 134830487) is 4,6-dichloro-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 4,6-dichloro-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 4,6-dichloro-2H-2,7-naphthyridin-1-one is O=c1[nH]cc(Cl)c2cc(Cl)ncc12.
What is the InChIKey of 4,6-dichloro-2H-2,7-naphthyridin-1-one?
The InChIKey is HZDCXLOERGXOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O/c9-6-3-12-8(13)5-2-11-7(10)1-4(5)6/h1-3H,(H,12,13).
What are the key properties of 4,6-dichloro-2H-2,7-naphthyridin-1-one?
4,6-dichloro-2H-2,7-naphthyridin-1-one has a molecular weight of 215.04 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 134830487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).