C8H5ClN2O — CID 138754785
7-chloro-2H-2,6-naphthyridin-3-one (PubChem CID 138754785) has the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. Its IUPAC name is 7-chloro-2H-2,6-naphthyridin-3-one.
| Compound Name | 7-chloro-2H-2,6-naphthyridin-3-one |
|---|---|
| PubChem CID | 138754785 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 7-chloro-2H-2,6-naphthyridin-3-one |
| SMILES | O=c1cc2cnc(Cl)cc2c[nH]1 |
| InChI | InChI=1S/C8H5ClN2O/c9-7-1-5-4-11-8(12)2-6(5)3-10-7/h1-4H,(H,11,12) |
| InChIKey | OTLSQRPSZQKHII-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|