About CID 176676606
CID 176676606 (PubChem CID 176676606) has the molecular formula C9H5BClNO
and a molecular weight of 189.41 g/mol.
Molecular Properties
| Compound Name | CID 176676606 |
| PubChem CID | 176676606 |
| Molecular Formula | C9H5BClNO |
| Molecular Weight | 189.41 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(=O)[nH]cc(Cl)c2c1 |
| InChI | InChI=1S/C9H5BClNO/c10-5-1-2-6-7(3-5)8(11)4-12-9(6)13/h1-4H,(H,12,13) |
| InChIKey | ANPRNUUDLSYEFS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.41 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 176676606 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176676606?
The IUPAC name of CID 176676606 (CID 176676606) is not available.
What is the SMILES notation for CID 176676606?
The canonical SMILES for CID 176676606 is [B]c1ccc2c(=O)[nH]cc(Cl)c2c1.
What is the InChIKey of CID 176676606?
The InChIKey is ANPRNUUDLSYEFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BClNO/c10-5-1-2-6-7(3-5)8(11)4-12-9(6)13/h1-4H,(H,12,13).
What are the key properties of CID 176676606?
CID 176676606 has a molecular weight of 189.41 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176676606 is sourced from PubChem (CID 176676606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).