C12H12ClN5O — CID 175520197
4-(2-azidobutan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one (PubChem CID 175520197) has the molecular formula C12H12ClN5O and a molecular weight of 277.72 g/mol. Its IUPAC name is 4-(2-azidobutan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one.
| Compound Name | 4-(2-azidobutan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 175520197 |
| Molecular Formula | C12H12ClN5O |
| Molecular Weight | 277.72 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-(2-azidobutan-2-yl)-6-chloro-2H-2,7-naphthyridin-1-one |
| SMILES | CCC(C)(N=[N+]=[N-])c1c[nH]c(=O)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C12H12ClN5O/c1-3-12(2,17-18-14)9-6-16-11(19)8-5-15-10(13)4-7(8)9/h4-6H,3H2,1-2H3,(H,16,19) |
| InChIKey | XIFNNJUWZVGZTM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|