C32H36Cl2N10O2 — CID 167612397
4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine;4-[(2S)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine (PubChem CID 167612397) has the molecular formula C32H36Cl2N10O2 and a molecular weight of 663.61 g/mol. Its IUPAC name is 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine;4-[(2S)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine.
| Compound Name | 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine;4-[(2S)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine |
|---|---|
| PubChem CID | 167612397 |
| Molecular Formula | C32H36Cl2N10O2 |
| Molecular Weight | 663.61 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | 4-[(2R)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine;4-[(2S)-2-azidobutan-2-yl]-6-chloro-1-(1-methylcyclopropyl)oxy-2,7-naphthyridine |
| SMILES | CC[C@@](C)(N=[N+]=[N-])c1cnc(OC2(C)CC2)c2cnc(Cl)cc12.CC[C@](C)(N=[N+]=[N-])c1cnc(OC2(C)CC2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/2C16H18ClN5O/c2*1-4-16(3,21-22-18)12-9-20-14(23-15(2)5-6-15)11-8-19-13(17)7-10(11)12/h2*7-9H,4-6H2,1-3H3/t2*16-/m10/s1 |
| InChIKey | LGADZAYDWCJSGP-RRHAQCGESA-N |
| XLogP | 10.30 |
| TPSA | 167.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.61 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|