About 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine
4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine (PubChem CID 165380906) has the molecular formula C13H14ClN5O
and a molecular weight of 291.74 g/mol. Its IUPAC name is 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine.
Molecular Properties
| Compound Name | 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine |
| PubChem CID | 165380906 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine |
| SMILES | COC[C@@](C)(N=[N+]=[N-])c1cnc(C)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C13H14ClN5O/c1-8-10-5-17-12(14)4-9(10)11(6-16-8)13(2,7-20-3)18-19-15/h4-6H,7H2,1-3H3/t13-/m1/s1 |
| InChIKey | CAHIYCRJJZSFGN-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine?
The IUPAC name of 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine (CID 165380906) is 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine.
What is the SMILES notation for 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine?
The canonical SMILES for 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine is COC[C@@](C)(N=[N+]=[N-])c1cnc(C)c2cnc(Cl)cc12.
What is the InChIKey of 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine?
The InChIKey is CAHIYCRJJZSFGN-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H14ClN5O/c1-8-10-5-17-12(14)4-9(10)11(6-16-8)13(2,7-20-3)18-19-15/h4-6H,7H2,1-3H3/t13-/m1/s1.
What are the key properties of 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine?
4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine has a molecular weight of 291.74 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2-azido-1-methoxypropan-2-yl]-6-chloro-1-methyl-2,7-naphthyridine is sourced from PubChem (CID 165380906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).