C21H26ClN5O4 — CID 175520201
tert-butyl 3-[5-(2-azido-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate (PubChem CID 175520201) has the molecular formula C21H26ClN5O4 and a molecular weight of 447.92 g/mol. Its IUPAC name is tert-butyl 3-[5-(2-azido-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(2-azido-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 175520201 |
| Molecular Formula | C21H26ClN5O4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | tert-butyl 3-[5-(2-azido-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate |
| SMILES | COCC(C)(N=[N+]=[N-])c1ccc(OC2CN(C(=O)OC(C)(C)C)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C21H26ClN5O4/c1-20(2,3)31-19(28)27-10-13(11-27)30-17-7-6-16(21(4,12-29-5)25-26-23)14-8-18(22)24-9-15(14)17/h6-9,13H,10-12H2,1-5H3 |
| InChIKey | VOBMCLIQTCNBIJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 109.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|