C21H26ClN3O4 — CID 171728017
tert-butyl (3R)-3-[[6-chloro-4-(1-ethoxyethenyl)-2,7-naphthyridin-1-yl]oxy]pyrrolidine-1-carboxylate (PubChem CID 171728017) has the molecular formula C21H26ClN3O4 and a molecular weight of 419.91 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[6-chloro-4-(1-ethoxyethenyl)-2,7-naphthyridin-1-yl]oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[6-chloro-4-(1-ethoxyethenyl)-2,7-naphthyridin-1-yl]oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 171728017 |
| Molecular Formula | C21H26ClN3O4 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl (3R)-3-[[6-chloro-4-(1-ethoxyethenyl)-2,7-naphthyridin-1-yl]oxy]pyrrolidine-1-carboxylate |
| SMILES | C=C(OCC)c1cnc(O[C@@H]2CCN(C(=O)OC(C)(C)C)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C21H26ClN3O4/c1-6-27-13(2)16-10-24-19(17-11-23-18(22)9-15(16)17)28-14-7-8-25(12-14)20(26)29-21(3,4)5/h9-11,14H,2,6-8,12H2,1,3-5H3/t14-/m1/s1 |
| InChIKey | NCMMQRHXTZEHDY-CQSZACIVSA-N |
| XLogP | 4.68 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|