C17H25ClN4O4 — CID 59507999
tert-butyl (3S)-3-(6-chloro-2-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidine-1-carboxylate (PubChem CID 59507999) has the molecular formula C17H25ClN4O4 and a molecular weight of 384.86 g/mol. Its IUPAC name is tert-butyl (3S)-3-(6-chloro-2-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(6-chloro-2-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59507999 |
| Molecular Formula | C17H25ClN4O4 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | tert-butyl (3S)-3-(6-chloro-2-morpholin-4-ylpyrimidin-4-yl)oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2cc(Cl)nc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C17H25ClN4O4/c1-17(2,3)26-16(23)22-5-4-12(11-22)25-14-10-13(18)19-15(20-14)21-6-8-24-9-7-21/h10,12H,4-9,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | WVYZDRRGQXGCSC-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |