C19H30N4O4 — CID 143514654
tert-butyl 3-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 143514654) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is tert-butyl 3-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 143514654 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | tert-butyl 3-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | Cc1cc(OC2CCCN(C(=O)OC(C)(C)C)C2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H30N4O4/c1-14-12-16(21-17(20-14)22-8-10-25-11-9-22)26-15-6-5-7-23(13-15)18(24)27-19(2,3)4/h12,15H,5-11,13H2,1-4H3 |
| InChIKey | SGJHSIUEEGAAEP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |