C21H28ClN3O4 — CID 165117565
tert-butyl 3-[5-(2-amino-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate (PubChem CID 165117565) has the molecular formula C21H28ClN3O4 and a molecular weight of 421.93 g/mol. Its IUPAC name is tert-butyl 3-[5-(2-amino-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(2-amino-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 165117565 |
| Molecular Formula | C21H28ClN3O4 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | tert-butyl 3-[5-(2-amino-1-methoxypropan-2-yl)-3-chloroisoquinolin-8-yl]oxyazetidine-1-carboxylate |
| SMILES | COCC(C)(N)c1ccc(OC2CN(C(=O)OC(C)(C)C)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C21H28ClN3O4/c1-20(2,3)29-19(26)25-10-13(11-25)28-17-7-6-16(21(4,23)12-27-5)14-8-18(22)24-9-15(14)17/h6-9,13H,10-12,23H2,1-5H3 |
| InChIKey | PJBXWEMEKWVQNL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|