C19H27ClN6O2S — CID 166483556
[(4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]-2-methylpentan-2-yl]-imino-methyl-oxo-λ6-sulfane (PubChem CID 166483556) has the molecular formula C19H27ClN6O2S and a molecular weight of 438.99 g/mol. Its IUPAC name is [(4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]-2-methylpentan-2-yl]-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [(4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]-2-methylpentan-2-yl]-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166483556 |
| Molecular Formula | C19H27ClN6O2S |
| Molecular Weight | 438.99 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | [(4R)-4-[[4-[(2R)-2-azidobutan-2-yl]-6-chloro-2,7-naphthyridin-1-yl]oxy]-2-methylpentan-2-yl]-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=[S@@](C)(=O)C(C)(C)C[C@@H](C)Oc1ncc([C@@](C)(CC)N=[N+]=[N-])c2cc(Cl)ncc12 |
| InChI | InChI=1S/C19H27ClN6O2S/c1-7-19(5,25-26-21)15-11-24-17(14-10-23-16(20)8-13(14)15)28-12(2)9-18(3,4)29(6,22)27/h8,10-12,22H,7,9H2,1-6H3/t12-,19-,29+/m1/s1 |
| InChIKey | AJPPLFZZWQZFDN-SYJRANSYSA-N |
| XLogP | 5.83 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.99 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|